Technical Data
Chemical name: | Citalopram hydrobromide |
Formula: | C20H22BrFN2O |
Molecular weight: | 405.3 |
CAS number: | 59729-32-7 |
SMILES: | Br.CN(C)CCCC1(OCc2cc(ccc12)C#N)c1ccc(F)cc1 |
Cat. No. BRC0198
Prices
Biological activity
It belongs to next groups of Bioreference compounds: | |
Therapeutic areas: | |
Target: | G-Protein-Coupled Receptors (GPCRs) Adrenergic receptor Histamine receptor Muscarinic acetylcholine receptor (mAChR) Transporters Ion Pumps Neurotransmitter transporter 5-HT Transporters |
Description: | |
Targets: | |
References: |