Technical Data
| Chemical name: | Lamotrigine |
| Formula: | C9H7Cl2N5 |
| Molecular weight: | 256.1 |
| CAS number: | 84057-84-1 |
| SMILES: | Nc1nnc(c(N)n1)-c1cccc(Cl)c1Cl |
Cat. No. BRC0155
Prices
Biological activity
| It belongs to next groups of Bioreference compounds: | |
| Therapeutic areas: | |
| Target: | G-Protein-Coupled Receptors (GPCRs) 5-hydroxytryptamine receptor (5-HT receptor) inhibitors Ion Channels Aquaporins Sodium channel Ligand-gated ion channels Transporters Aquaporins |
| Description: | |
| Targets: | |
| References: | |