Estrone
NSC 9699, WAY 164397
Technical Data
Chemical name: | Estrone |
Formula: | C18H22O2 |
Molecular weight: | 270.4 |
CAS number: | 53-16-7 |
SMILES: | C[C@]12CC[C@H]3[C@@H](CCc4cc(O)ccc34)[C@@H]1CCC2=O |
Cat. No. BRC0796
Prices
Biological activity
It belongs to next groups of Bioreference compounds: | |
Therapeutic areas: | |
Target: | Enzymes Cytochrome P450 (CYP) Nuclear Receptors (nuclear hormone receptors) Androgen receptor |
Description: | Estrone is an estradiol metabolite, estrogen receptor agonist. |
Targets: | Estrogen receptor alpha, Estrogen receptor beta, Androgen receptor, Cytochrome P450 19A1, Sex hormone-binding globulin |
References: | 1. Endocrinology. 1997; 138, 3, 863.; 2. Environ Sci Technol. 2002; 36, 20, 4410.; 3. Chemosphere. 2004; 57, 11, 1649.; |