Thalidomide
Thalomid, Distaval, Softenon, Talimol,
Technical Data
Chemical name: | Thalidomide |
Formula: | C13H10N2O4 |
Molecular weight: | 258.2 |
CAS number: | 50-35-1 |
SMILES: | O=C1N(C2CCC(=O)NC2=O)C(=O)c2ccccc12 |
Cat. No. BRC0121
Prices
Biological activity
It belongs to next groups of Bioreference compounds: | |
Target: | Kinases Vascular endothelial growth factor (VEGF) Enzymes Kinases Ligases Enzyme-Linked Receptors Cytokine receptors Receptor Tyrosine Kinase DNA SUBDNA |
Description: | Thalidomide is an immunomodulatory agent with a spectrum of activity that is not fully characterized. Thalidomide is racemic — it contains both left and right handed isomers in equal amounts: one enantiomer is effective against morning sickness, and the other is teratogenic. |
Targets: | Protein cereblon, Tumor necrosis factor, Nuclear factor NF-kappa-B p105 subunit, DNA, Fibroblast growth factor receptor 2, Prostaglandin G/H synthase 2, Nuclear factor kappa-light-chain-enhancer of activated B cells, alpha1-acid glycoprotein |
References: | 1. J. Exp. Med. 1991; 173: 699-703.; 2. Proc. Natl. Acad. Sci. U.S.A. 1994; 91: 4082-4085.; 3. Proc. Natl. Acad. Sci. U.S.A. 1993; 90: 5974-5978.; 4. Angiogenesis. 1999; 3: 201-204.; 5. Semin. Oncol. 2001; 28: 536-542.; |