Technical Data
| Chemical name: | Paroxetine hydrochloride |
| Formula: | C19H21ClFNO3 |
| Molecular weight: | 365.8 |
| CAS number: | 78246-49-8 |
| SMILES: | Cl.Fc1ccc(cc1)[C@@H]1CCNC[C@H]1COc1ccc2OCOc2c1 |
Cat. No. BRC0409
Prices
Biological activity
| It belongs to next groups of Bioreference compounds: | |
| Therapeutic areas: | CNS Agents Neurotransmitter Agents Antidepressive Agents Antipsychotics |
| Target: | G-Protein-Coupled Receptors (GPCRs) Muscarinic acetylcholine receptor (mAChR) 5-hydroxytryptamine receptor (5-HT receptor) inhibitors Ion Channels Ligand-gated ion channels Transporters Ion Pumps Neurotransmitter transporter 5-HT Transporters Multidrug Transporter Inhibitors P-glycoprotein/ABCB1 |
| Description: | |
| Targets: | |
| References: | |