Technical Data
| Chemical name: | Fluoxetine Hydrochloride |
| Formula: | C17H19ClF3NO |
| Molecular weight: | 345.8 |
| CAS number: | 56296-78-7 |
| SMILES: | Cl.CNCCC(OC1=CC=C(C=C1)C(F)(F)F)C1=CC=CC=C1 |
Cat. No. BRC0838
Prices
Biological activity
| It belongs to next groups of Bioreference compounds: | |
| Therapeutic areas: | |
| Target: | Kinases Cyclin-dependent protein kinases (CDK) G-Protein-Coupled Receptors (GPCRs) 5-hydroxytryptamine receptor (5-HT receptor) inhibitors Kinases Ion Channels Potassium channel Ligand-gated ion channels Transporters Ion Pumps Neurotransmitter transporter Multidrug Transporter Inhibitors P-glycoprotein/ABCB1 |
| Description: | |
| Targets: | |
| References: | |