Fluoxetine Hydrochloride
Lilly 103472; Lilly 110 140; Prozac;
Technical Data
| Chemical name: | Fluoxetine Hydrochloride |
| Formula: | C17H19ClF3NO |
| Molecular weight: | 345.8 |
| CAS number: | 56296-78-7 |
| SMILES: | Cl.CNCCC(OC1=CC=C(C=C1)C(F)(F)F)C1=CC=CC=C1 |
Cat. No. BRC0838
Prices
Biological activity
| It belongs to next groups of Bioreference compounds: | |
| Therapeutic areas: | |
| Target: | Kinases Cyclin-dependent protein kinases (CDK) G-Protein-Coupled Receptors (GPCRs) 5-hydroxytryptamine receptor (5-HT receptor) inhibitors Kinases Ion Channels Potassium channel Ligand-gated ion channels Transporters Ion Pumps Neurotransmitter transporter Multidrug Transporter Inhibitors P-glycoprotein/ABCB1 |
| Description: | Fluoxetine hydrochloride is the first-in-class antidepressant, selective serotonin-reuptake inhibitor. It displays a selectivity for the serotonin transporter (Kd = 0.81 nM) over the norepinephrine transporter (Kd = 240 nM) and the dopamine transporter (Kd = 3,600 nM). It is used in the clinical treatment of major depression as well as other psychiatric disorders. |
| Targets: | Sodium-dependent serotonin transporter; Potassium voltage-gated channel subfamily H member 2; 5-hydroxytryptamine receptor 2C; Cyclin-dependent kinases regulatory subunit 1; |
| References: | 1. Biochem Pharmacol. 2008; 75(10), 1924-34.; 2. Eur J Med Chem. 1997; 32, 3, 205 - 218.; 3. Life Sciences. 1995; 57, 8, 791 - 802.; |