Lanicemine
ARL 15896; FPL 15896; AR-R15896; AZD6765;
Technical Data
| Chemical name: | Lanicemine |
| Formula: | C13H14N2 |
| Molecular weight: | 198.3 |
| CAS number: | 153322-05-5 |
| SMILES: | N[C@@H](CC1=NC=CC=C1)C1=CC=CC=C1 |
Cat. No. BRC1074
Prices
Biological activity
| It belongs to next groups of Bioreference compounds: | |
| Therapeutic areas: | |
| Target: | G-Protein-Coupled Receptors (GPCRs) Glutamate receptor Ion Channels Ligand-gated ion channels Transporters Ion Pumps |
| Description: | Lanicemine is a non-selective, voltage-dependent NMDA channel blocker (IC50 = 4-7 µM). It has been used in trials studying the treatment and basic science of Depression, Major Depressive Disorder, and Treatment-Resistant Major Depressive Disorder. |
| Targets: | Glutamate receptor ionotropic, NMDA 2D; |
| References: | 1. Brain Res. 2006; 1114, 1, 36 - 40.; 2. Eur J Pharmacol. 2002; 443, 1-3, 79 - 83.; 3. Bioorg Med Chem. 2009; 17, 9, 3456 - 3462.; |