Antipyrine
Technical Data
| Chemical name: | Antipyrine |
| Formula: | C11H12N2O |
| Molecular weight: | 188.2 |
| CAS number: | 60-80-0 |
| SMILES: | CN1N(C(=O)C=C1C)C1=CC=CC=C1 |
Cat. No. BRC0978
Prices
Biological activity
| It belongs to next groups of Bioreference compounds: | |
| Therapeutic areas: | |
| Target: | |
| Description: | Antipyrine is an analgesic and antipyretic. It inhibits isoforms of cyclooxygenase, COX-1, COX-2, and COX-3 enzymes involved in prostaglandin (PG) synthesis. Antipyrine is often used in testing the effects of other drugs or diseases on drug-metabolizing enzymes in the liver. |
| Targets: | Prostaglandin G/H synthase 2; Prostaglandin G/H synthase 1; |
| References: | 1. Curr Drug Metab. 2010; 11, 2, 153 - 161.; 2. Drug Metab Dispos. 2000; 28, 12, 1518 - 1523.; 3. Clin Pharmacol Ther. 2007; 82, 3, 265 - 274.; |