Technical Data
| Chemical name: | Duloxetine hydrochloride |
| Formula: | C18H20ClNOS |
| Molecular weight: | 333.9 |
| CAS number: | 136434-34-9 |
| SMILES: | Cl.CNCC[C@H](Oc1cccc2ccccc12)c1cccs1 |
Cat. No. BRC0736
Prices
Biological activity
| It belongs to next groups of Bioreference compounds: | |
| Therapeutic areas: | Analgesics CNS Agents Neurotransmitter Agents Antidepressive Agents |
| Target: | G-Protein-Coupled Receptors (GPCRs) Dopamine receptor Ion Channels Sodium channel |
| Description: | |
| Targets: | |
| References: | |